C18H33BrOSi — CID 24777979
[(Z,3S)-1-bromododec-4-en-1-yn-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 24777979) has the molecular formula C18H33BrOSi and a molecular weight of 373.45 g/mol. Its IUPAC name is [(Z,3S)-1-bromododec-4-en-1-yn-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(Z,3S)-1-bromododec-4-en-1-yn-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 24777979 |
| Molecular Formula | C18H33BrOSi |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 372.15 |
| IUPAC Name | [(Z,3S)-1-bromododec-4-en-1-yn-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CCCCCCC/C=C\[C@@H](C#CBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C18H33BrOSi/c1-7-8-9-10-11-12-13-14-17(15-16-19)20-21(5,6)18(2,3)4/h13-14,17H,7-12H2,1-6H3/b14-13-/t17-/m0/s1 |
| InChIKey | JTMJWCGUDZRBJE-NJWFCXLTSA-N |
| XLogP | 6.65 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 6.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|