C17H27BrOSi — CID 146162894
[(E,3R)-11-bromoundec-4-en-6,9-diyn-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 146162894) has the molecular formula C17H27BrOSi and a molecular weight of 355.39 g/mol. Its IUPAC name is [(E,3R)-11-bromoundec-4-en-6,9-diyn-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E,3R)-11-bromoundec-4-en-6,9-diyn-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 146162894 |
| Molecular Formula | C17H27BrOSi |
| Molecular Weight | 355.39 g/mol |
| Exact Mass | 354.10 |
| IUPAC Name | [(E,3R)-11-bromoundec-4-en-6,9-diyn-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC[C@H](/C=C/C#CCC#CCBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H27BrOSi/c1-7-16(19-20(5,6)17(2,3)4)14-12-10-8-9-11-13-15-18/h12,14,16H,7,9,15H2,1-6H3/b14-12+/t16-/m1/s1 |
| InChIKey | BSWGVCMSVWVJQY-WCRPCQDQSA-N |
| XLogP | 5.13 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 355.39 |
| LogP ≤ 5 | 5.13 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|