C12H21BrOSi — CID 11208484
[(E,2S)-6-bromohex-3-en-5-yn-2-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 11208484) has the molecular formula C12H21BrOSi and a molecular weight of 289.29 g/mol. Its IUPAC name is [(E,2S)-6-bromohex-3-en-5-yn-2-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(E,2S)-6-bromohex-3-en-5-yn-2-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11208484 |
| Molecular Formula | C12H21BrOSi |
| Molecular Weight | 289.29 g/mol |
| Exact Mass | 288.05 |
| IUPAC Name | [(E,2S)-6-bromohex-3-en-5-yn-2-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C[C@@H](/C=C/C#CBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C12H21BrOSi/c1-11(9-7-8-10-13)14-15(5,6)12(2,3)4/h7,9,11H,1-6H3/b9-7+/t11-/m0/s1 |
| InChIKey | VPEIVCLDOIYUCR-DJYGCBNOSA-N |
| XLogP | 4.31 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 289.29 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|