C14H27BrOSi — CID 101492997
[(3R,4E,6Z)-8-bromoocta-4,6-dien-3-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 101492997) has the molecular formula C14H27BrOSi and a molecular weight of 319.36 g/mol. Its IUPAC name is [(3R,4E,6Z)-8-bromoocta-4,6-dien-3-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(3R,4E,6Z)-8-bromoocta-4,6-dien-3-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 101492997 |
| Molecular Formula | C14H27BrOSi |
| Molecular Weight | 319.36 g/mol |
| Exact Mass | 318.10 |
| IUPAC Name | [(3R,4E,6Z)-8-bromoocta-4,6-dien-3-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | CC[C@H](/C=C/C=C\CBr)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H27BrOSi/c1-7-13(11-9-8-10-12-15)16-17(5,6)14(2,3)4/h8-11,13H,7,12H2,1-6H3/b10-8-,11-9+/t13-/m1/s1 |
| InChIKey | ICYISIBJXCXNOK-VAXKBXNHSA-N |
| XLogP | 5.29 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.36 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|