C13H25BrOSi — CID 134987961
[(E)-6-bromo-2-methylidenehex-3-enoxy]-tert-butyl-dimethylsilane (PubChem CID 134987961) has the molecular formula C13H25BrOSi and a molecular weight of 305.33 g/mol. Its IUPAC name is [(E)-6-bromo-2-methylidenehex-3-enoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(E)-6-bromo-2-methylidenehex-3-enoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 134987961 |
| Molecular Formula | C13H25BrOSi |
| Molecular Weight | 305.33 g/mol |
| Exact Mass | 304.09 |
| IUPAC Name | [(E)-6-bromo-2-methylidenehex-3-enoxy]-tert-butyl-dimethylsilane |
| SMILES | C=C(/C=C/CCBr)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C13H25BrOSi/c1-12(9-7-8-10-14)11-15-16(5,6)13(2,3)4/h7,9H,1,8,10-11H2,2-6H3/b9-7+ |
| InChIKey | JABMJXXSUMZSBI-VQHVLOKHSA-N |
| XLogP | 4.91 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.33 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|