C14H24BrClOSi — CID 154712251
[(3Z)-3-bromo-4-chloro-5-methylidenehepta-3,6-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 154712251) has the molecular formula C14H24BrClOSi and a molecular weight of 351.79 g/mol. Its IUPAC name is [(3Z)-3-bromo-4-chloro-5-methylidenehepta-3,6-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(3Z)-3-bromo-4-chloro-5-methylidenehepta-3,6-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 154712251 |
| Molecular Formula | C14H24BrClOSi |
| Molecular Weight | 351.79 g/mol |
| Exact Mass | 350.05 |
| IUPAC Name | [(3Z)-3-bromo-4-chloro-5-methylidenehepta-3,6-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | C=CC(=C)/C(Cl)=C(/Br)CCO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C14H24BrClOSi/c1-8-11(2)13(16)12(15)9-10-17-18(6,7)14(3,4)5/h8H,1-2,9-10H2,3-7H3/b13-12- |
| InChIKey | XHNRMUVSVXNUFR-SEYXRHQNSA-N |
| XLogP | 5.99 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.79 |
| LogP ≤ 5 | 5.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|