C15H27BrOSi — CID 164671391
[(1E,3E,5R,7Z)-1-bromonona-1,3,7-trien-5-yl]oxy-tert-butyl-dimethylsilane (PubChem CID 164671391) has the molecular formula C15H27BrOSi and a molecular weight of 331.37 g/mol. Its IUPAC name is [(1E,3E,5R,7Z)-1-bromonona-1,3,7-trien-5-yl]oxy-tert-butyl-dimethylsilane.
| Compound Name | [(1E,3E,5R,7Z)-1-bromonona-1,3,7-trien-5-yl]oxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 164671391 |
| Molecular Formula | C15H27BrOSi |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [(1E,3E,5R,7Z)-1-bromonona-1,3,7-trien-5-yl]oxy-tert-butyl-dimethylsilane |
| SMILES | C/C=C\C[C@H](/C=C/C=C/Br)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H27BrOSi/c1-7-8-11-14(12-9-10-13-16)17-18(5,6)15(2,3)4/h7-10,12-14H,11H2,1-6H3/b8-7-,12-9+,13-10+/t14-/m1/s1 |
| InChIKey | OZDLWFKXSCPXAY-BXFYWZFISA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|