C12H23BrOSi — CID 76790546
(5-bromo-4-methylpenta-2,4-dienoxy)-tert-butyl-dimethylsilane (PubChem CID 76790546) has the molecular formula C12H23BrOSi and a molecular weight of 291.31 g/mol. Its IUPAC name is (5-bromo-4-methylpenta-2,4-dienoxy)-tert-butyl-dimethylsilane.
| Compound Name | (5-bromo-4-methylpenta-2,4-dienoxy)-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 76790546 |
| Molecular Formula | C12H23BrOSi |
| Molecular Weight | 291.31 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | (5-bromo-4-methylpenta-2,4-dienoxy)-tert-butyl-dimethylsilane |
| SMILES | CC(C=CCO[Si](C)(C)C(C)(C)C)=CBr |
| InChI | InChI=1S/C12H23BrOSi/c1-11(10-13)8-7-9-14-15(5,6)12(2,3)4/h7-8,10H,9H2,1-6H3 |
| InChIKey | DONNRMVTEVHMRC-UHFFFAOYSA-N |
| XLogP | 4.86 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.31 |
| LogP ≤ 5 | 4.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|