C12H23BrOSiZn — CID 134897038
bromozinc(1+);tert-butyl-dimethyl-[(2E)-4-methylpenta-2,4-dienoxy]silane (PubChem CID 134897038) has the molecular formula C12H23BrOSiZn and a molecular weight of 356.70 g/mol. Its IUPAC name is bromozinc(1+);tert-butyl-dimethyl-[(2E)-4-methylpenta-2,4-dienoxy]silane.
| Compound Name | bromozinc(1+);tert-butyl-dimethyl-[(2E)-4-methylpenta-2,4-dienoxy]silane |
|---|---|
| PubChem CID | 134897038 |
| Molecular Formula | C12H23BrOSiZn |
| Molecular Weight | 356.70 g/mol |
| Exact Mass | 354.00 |
| IUPAC Name | bromozinc(1+);tert-butyl-dimethyl-[(2E)-4-methylpenta-2,4-dienoxy]silane |
| SMILES | [H]/[C-]=C(C)\C=C\CO[Si](C)(C)C(C)(C)C.[Zn+]Br |
| InChI | InChI=1S/C12H23OSi.BrH.Zn/c1-11(2)9-8-10-13-14(6,7)12(3,4)5;;/h1,8-9H,10H2,2-7H3;1H;/q-1;;+2/p-1/b9-8+;; |
| InChIKey | PGVRIFWLXXNRIP-YEUQMBKVSA-M |
| XLogP | 4.79 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 356.70 |
| LogP ≤ 5 | 4.79 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|