C15H27BrOSiZn — CID 134898095
bromozinc(1+);tert-butyl-[(2E,4E)-4,6-dimethylhepta-2,4,6-trienoxy]-dimethylsilane (PubChem CID 134898095) has the molecular formula C15H27BrOSiZn and a molecular weight of 396.76 g/mol. Its IUPAC name is bromozinc(1+);tert-butyl-[(2E,4E)-4,6-dimethylhepta-2,4,6-trienoxy]-dimethylsilane.
| Compound Name | bromozinc(1+);tert-butyl-[(2E,4E)-4,6-dimethylhepta-2,4,6-trienoxy]-dimethylsilane |
|---|---|
| PubChem CID | 134898095 |
| Molecular Formula | C15H27BrOSiZn |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 394.03 |
| IUPAC Name | bromozinc(1+);tert-butyl-[(2E,4E)-4,6-dimethylhepta-2,4,6-trienoxy]-dimethylsilane |
| SMILES | [H]/[C-]=C(C)\C=C(C)\C=C\CO[Si](C)(C)C(C)(C)C.[Zn+]Br |
| InChI | InChI=1S/C15H27OSi.BrH.Zn/c1-13(2)12-14(3)10-9-11-16-17(7,8)15(4,5)6;;/h1,9-10,12H,11H2,2-8H3;1H;/q-1;;+2/p-1/b10-9+,14-12+;; |
| InChIKey | LFYQWNHHDMLHFM-OHSMBGTOSA-M |
| XLogP | 5.73 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|