C22H41BrO2Si2 — CID 11374890
[(1R,3E)-1-[(1E,3E)-4-bromobuta-1,3-dienyl]-3,6-dimethyl-5-trimethylsilyloxyhepta-3,5-dienoxy]-tert-butyl-dimethylsilane (PubChem CID 11374890) has the molecular formula C22H41BrO2Si2 and a molecular weight of 473.64 g/mol. Its IUPAC name is [(1R,3E)-1-[(1E,3E)-4-bromobuta-1,3-dienyl]-3,6-dimethyl-5-trimethylsilyloxyhepta-3,5-dienoxy]-tert-butyl-dimethylsilane.
| Compound Name | [(1R,3E)-1-[(1E,3E)-4-bromobuta-1,3-dienyl]-3,6-dimethyl-5-trimethylsilyloxyhepta-3,5-dienoxy]-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 11374890 |
| Molecular Formula | C22H41BrO2Si2 |
| Molecular Weight | 473.64 g/mol |
| Exact Mass | 472.18 |
| IUPAC Name | [(1R,3E)-1-[(1E,3E)-4-bromobuta-1,3-dienyl]-3,6-dimethyl-5-trimethylsilyloxyhepta-3,5-dienoxy]-tert-butyl-dimethylsilane |
| SMILES | CC(C)=C(/C=C(\C)C[C@H](/C=C/C=C/Br)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C22H41BrO2Si2/c1-18(2)21(25-26(7,8)9)17-19(3)16-20(14-12-13-15-23)24-27(10,11)22(4,5)6/h12-15,17,20H,16H2,1-11H3/b14-12+,15-13+,19-17+/t20-/m0/s1 |
| InChIKey | WBKWBLNHRVTMCR-FYIZIJHASA-N |
| XLogP | 8.32 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 473.64 |
| LogP ≤ 5 | 8.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|