C22H44O2Si2 — CID 102065734
tributyl-[(1R)-4-trimethylsilyloxycyclohepta-2,4-dien-1-yl]oxysilane (PubChem CID 102065734) has the molecular formula C22H44O2Si2 and a molecular weight of 396.76 g/mol. Its IUPAC name is tributyl-[(1R)-4-trimethylsilyloxycyclohepta-2,4-dien-1-yl]oxysilane.
| Compound Name | tributyl-[(1R)-4-trimethylsilyloxycyclohepta-2,4-dien-1-yl]oxysilane |
|---|---|
| PubChem CID | 102065734 |
| Molecular Formula | C22H44O2Si2 |
| Molecular Weight | 396.76 g/mol |
| Exact Mass | 396.29 |
| IUPAC Name | tributyl-[(1R)-4-trimethylsilyloxycyclohepta-2,4-dien-1-yl]oxysilane |
| SMILES | CCCC[Si](CCCC)(CCCC)O[C@H]1C=CC(O[Si](C)(C)C)=CCC1 |
| InChI | InChI=1S/C22H44O2Si2/c1-7-10-18-26(19-11-8-2,20-12-9-3)24-22-15-13-14-21(16-17-22)23-25(4,5)6/h14,16-17,22H,7-13,15,18-20H2,1-6H3/t22-/m1/s1 |
| InChIKey | RLUKWELKNRTMAZ-JOCHJYFZSA-N |
| XLogP | 7.80 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.76 |
| LogP ≤ 5 | 7.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|