C15H27BrOSi — CID 164668977
[(5E,7E)-2-bromonona-1,5,7-trien-4-yl]oxy-triethylsilane (PubChem CID 164668977) has the molecular formula C15H27BrOSi and a molecular weight of 331.37 g/mol. Its IUPAC name is [(5E,7E)-2-bromonona-1,5,7-trien-4-yl]oxy-triethylsilane.
| Compound Name | [(5E,7E)-2-bromonona-1,5,7-trien-4-yl]oxy-triethylsilane |
|---|---|
| PubChem CID | 164668977 |
| Molecular Formula | C15H27BrOSi |
| Molecular Weight | 331.37 g/mol |
| Exact Mass | 330.10 |
| IUPAC Name | [(5E,7E)-2-bromonona-1,5,7-trien-4-yl]oxy-triethylsilane |
| SMILES | C=C(Br)CC(/C=C/C=C/C)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C15H27BrOSi/c1-6-10-11-12-15(13-14(5)16)17-18(7-2,8-3)9-4/h6,10-12,15H,5,7-9,13H2,1-4H3/b10-6+,12-11+ |
| InChIKey | MHGCPHFVYPQVNA-OAJVOTDOSA-N |
| XLogP | 5.81 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 18 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.37 |
| LogP ≤ 5 | 5.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|