C21H41BrOSi2 — CID 135020838
[(2E)-5-bromo-1-prop-2-enyl-3-triethylsilylhexa-2,5-dienoxy]-triethylsilane (PubChem CID 135020838) has the molecular formula C21H41BrOSi2 and a molecular weight of 445.63 g/mol. Its IUPAC name is [(2E)-5-bromo-1-prop-2-enyl-3-triethylsilylhexa-2,5-dienoxy]-triethylsilane.
| Compound Name | [(2E)-5-bromo-1-prop-2-enyl-3-triethylsilylhexa-2,5-dienoxy]-triethylsilane |
|---|---|
| PubChem CID | 135020838 |
| Molecular Formula | C21H41BrOSi2 |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 444.19 |
| IUPAC Name | [(2E)-5-bromo-1-prop-2-enyl-3-triethylsilylhexa-2,5-dienoxy]-triethylsilane |
| SMILES | C=CCC(/C=C(\CC(=C)Br)[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C21H41BrOSi2/c1-9-16-20(23-25(13-5,14-6)15-7)18-21(17-19(8)22)24(10-2,11-3)12-4/h9,18,20H,1,8,10-17H2,2-7H3/b21-18+ |
| InChIKey | CSKGQNFWPQEZPU-DYTRJAOYSA-N |
| XLogP | 8.23 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|