C22H44OSi2 — CID 135020837
triethyl-[(2E)-5-methyl-1-prop-2-enyl-3-triethylsilylhexa-2,5-dienoxy]silane (PubChem CID 135020837) has the molecular formula C22H44OSi2 and a molecular weight of 380.77 g/mol. Its IUPAC name is triethyl-[(2E)-5-methyl-1-prop-2-enyl-3-triethylsilylhexa-2,5-dienoxy]silane.
| Compound Name | triethyl-[(2E)-5-methyl-1-prop-2-enyl-3-triethylsilylhexa-2,5-dienoxy]silane |
|---|---|
| PubChem CID | 135020837 |
| Molecular Formula | C22H44OSi2 |
| Molecular Weight | 380.77 g/mol |
| Exact Mass | 380.29 |
| IUPAC Name | triethyl-[(2E)-5-methyl-1-prop-2-enyl-3-triethylsilylhexa-2,5-dienoxy]silane |
| SMILES | C=CCC(/C=C(\CC(=C)C)[Si](CC)(CC)CC)O[Si](CC)(CC)CC |
| InChI | InChI=1S/C22H44OSi2/c1-10-17-21(23-25(14-5,15-6)16-7)19-22(18-20(8)9)24(11-2,12-3)13-4/h10,19,21H,1,8,11-18H2,2-7,9H3/b22-19+ |
| InChIKey | KNYHCJYTYMSWCA-ZBJSNUHESA-N |
| XLogP | 7.89 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.77 |
| LogP ≤ 5 | 7.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|