C17H34O2Si2 — CID 5366568
trimethyl-[(5Z,8Z)-7-trimethylsilyloxyundeca-1,5,8-trien-3-yl]oxysilane (PubChem CID 5366568) has the molecular formula C17H34O2Si2 and a molecular weight of 326.63 g/mol. Its IUPAC name is trimethyl-[(5Z,8Z)-7-trimethylsilyloxyundeca-1,5,8-trien-3-yl]oxysilane.
| Compound Name | trimethyl-[(5Z,8Z)-7-trimethylsilyloxyundeca-1,5,8-trien-3-yl]oxysilane |
|---|---|
| PubChem CID | 5366568 |
| Molecular Formula | C17H34O2Si2 |
| Molecular Weight | 326.63 g/mol |
| Exact Mass | 326.21 |
| IUPAC Name | trimethyl-[(5Z,8Z)-7-trimethylsilyloxyundeca-1,5,8-trien-3-yl]oxysilane |
| SMILES | C=CC(C/C=C\C(/C=C\CC)O[Si](C)(C)C)O[Si](C)(C)C |
| InChI | InChI=1S/C17H34O2Si2/c1-9-11-13-17(19-21(6,7)8)15-12-14-16(10-2)18-20(3,4)5/h10-13,15-17H,2,9,14H2,1,3-8H3/b13-11-,15-12- |
| InChIKey | KRIKPTWBGKMGNE-LJACRCCUSA-N |
| XLogP | 5.53 |
| TPSA | 18.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.63 |
| LogP ≤ 5 | 5.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|