C13H25NO — CID 89381339
N,N-dimethyl-3-[(3R,5E)-octa-1,5-dien-3-yl]oxypropan-1-amine (PubChem CID 89381339) has the molecular formula C13H25NO and a molecular weight of 211.35 g/mol. Its IUPAC name is N,N-dimethyl-3-[(3R,5E)-octa-1,5-dien-3-yl]oxypropan-1-amine.
| Compound Name | N,N-dimethyl-3-[(3R,5E)-octa-1,5-dien-3-yl]oxypropan-1-amine |
|---|---|
| PubChem CID | 89381339 |
| Molecular Formula | C13H25NO |
| Molecular Weight | 211.35 g/mol |
| Exact Mass | 211.19 |
| IUPAC Name | N,N-dimethyl-3-[(3R,5E)-octa-1,5-dien-3-yl]oxypropan-1-amine |
| SMILES | C=C[C@@H](C/C=C/CC)OCCCN(C)C |
| InChI | InChI=1S/C13H25NO/c1-5-7-8-10-13(6-2)15-12-9-11-14(3)4/h6-8,13H,2,5,9-12H2,1,3-4H3/b8-7+/t13-/m0/s1 |
| InChIKey | VLPDHXXYVPIPTO-GWJCSSMESA-N |
| XLogP | 2.87 |
| TPSA | 12.47 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.35 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|