C12H26N2 — CID 88890905
N-[(Z)-hept-4-enyl]-N',N'-dimethylpropane-1,3-diamine (PubChem CID 88890905) has the molecular formula C12H26N2 and a molecular weight of 198.35 g/mol. Its IUPAC name is N-[(Z)-hept-4-enyl]-N',N'-dimethylpropane-1,3-diamine.
| Compound Name | N-[(Z)-hept-4-enyl]-N',N'-dimethylpropane-1,3-diamine |
|---|---|
| PubChem CID | 88890905 |
| Molecular Formula | C12H26N2 |
| Molecular Weight | 198.35 g/mol |
| Exact Mass | 198.21 |
| IUPAC Name | N-[(Z)-hept-4-enyl]-N',N'-dimethylpropane-1,3-diamine |
| SMILES | CC/C=C\CCCNCCCN(C)C |
| InChI | InChI=1S/C12H26N2/c1-4-5-6-7-8-10-13-11-9-12-14(2)3/h5-6,13H,4,7-12H2,1-3H3/b6-5- |
| InChIKey | BZDWAWQQWLNJOO-WAYWQWQTSA-N |
| XLogP | 2.27 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.35 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|