C12H22OSi — CID 10846154
[(3S,4R)-4-ethenylhepta-1,6-dien-3-yl]oxy-trimethylsilane (PubChem CID 10846154) has the molecular formula C12H22OSi and a molecular weight of 210.39 g/mol. Its IUPAC name is [(3S,4R)-4-ethenylhepta-1,6-dien-3-yl]oxy-trimethylsilane.
| Compound Name | [(3S,4R)-4-ethenylhepta-1,6-dien-3-yl]oxy-trimethylsilane |
|---|---|
| PubChem CID | 10846154 |
| Molecular Formula | C12H22OSi |
| Molecular Weight | 210.39 g/mol |
| Exact Mass | 210.14 |
| IUPAC Name | [(3S,4R)-4-ethenylhepta-1,6-dien-3-yl]oxy-trimethylsilane |
| SMILES | C=CC[C@H](C=C)[C@H](C=C)O[Si](C)(C)C |
| InChI | InChI=1S/C12H22OSi/c1-7-10-11(8-2)12(9-3)13-14(4,5)6/h7-9,11-12H,1-3,10H2,4-6H3/t11-,12-/m0/s1 |
| InChIKey | OENJNZPJSKUOFJ-RYUDHWBXSA-N |
| XLogP | 3.77 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.39 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|