C8H15NO2S — CID 166830456
(2R,3R)-3-ethenylhex-5-ene-2-sulfonamide (PubChem CID 166830456) has the molecular formula C8H15NO2S and a molecular weight of 189.28 g/mol. Its IUPAC name is (2R,3R)-3-ethenylhex-5-ene-2-sulfonamide.
| Compound Name | (2R,3R)-3-ethenylhex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 166830456 |
| Molecular Formula | C8H15NO2S |
| Molecular Weight | 189.28 g/mol |
| Exact Mass | 189.08 |
| IUPAC Name | (2R,3R)-3-ethenylhex-5-ene-2-sulfonamide |
| SMILES | C=CC[C@H](C=C)[C@@H](C)S(N)(=O)=O |
| InChI | InChI=1S/C8H15NO2S/c1-4-6-8(5-2)7(3)12(9,10)11/h4-5,7-8H,1-2,6H2,3H3,(H2,9,10,11)/t7-,8+/m1/s1 |
| InChIKey | SFXSLBGMVAADTK-SFYZADRCSA-N |
| XLogP | 1.04 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 189.28 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|