C9H14N2O2S2 — CID 130367201
(2R)-3-(1,3-thiazol-2-yl)hex-5-ene-2-sulfonamide (PubChem CID 130367201) has the molecular formula C9H14N2O2S2 and a molecular weight of 246.36 g/mol. Its IUPAC name is (2R)-3-(1,3-thiazol-2-yl)hex-5-ene-2-sulfonamide.
| Compound Name | (2R)-3-(1,3-thiazol-2-yl)hex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 130367201 |
| Molecular Formula | C9H14N2O2S2 |
| Molecular Weight | 246.36 g/mol |
| Exact Mass | 246.05 |
| IUPAC Name | (2R)-3-(1,3-thiazol-2-yl)hex-5-ene-2-sulfonamide |
| SMILES | C=CCC(c1nccs1)[C@@H](C)S(N)(=O)=O |
| InChI | InChI=1S/C9H14N2O2S2/c1-3-4-8(7(2)15(10,12)13)9-11-5-6-14-9/h3,5-8H,1,4H2,2H3,(H2,10,12,13)/t7-,8?/m1/s1 |
| InChIKey | ZBFBMZFMSNUEPC-GVHYBUMESA-N |
| XLogP | 1.48 |
| TPSA | 73.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.36 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|