C5H6INS — CID 89231680
2-(1-iodoethyl)-1,3-thiazole (PubChem CID 89231680) has the molecular formula C5H6INS and a molecular weight of 239.08 g/mol. Its IUPAC name is 2-(1-iodoethyl)-1,3-thiazole.
| Compound Name | 2-(1-iodoethyl)-1,3-thiazole |
|---|---|
| PubChem CID | 89231680 |
| Molecular Formula | C5H6INS |
| Molecular Weight | 239.08 g/mol |
| Exact Mass | 238.93 |
| IUPAC Name | 2-(1-iodoethyl)-1,3-thiazole |
| SMILES | CC(I)c1nccs1 |
| InChI | InChI=1S/C5H6INS/c1-4(6)5-7-2-3-8-5/h2-4H,1H3 |
| InChIKey | CMNBPUXGNINFSJ-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 239.08 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|