C7H10ClNS — CID 63202984
2-(3-chlorobutan-2-yl)-1,3-thiazole (PubChem CID 63202984) has the molecular formula C7H10ClNS and a molecular weight of 175.68 g/mol. Its IUPAC name is 2-(3-chlorobutan-2-yl)-1,3-thiazole.
| Compound Name | 2-(3-chlorobutan-2-yl)-1,3-thiazole |
|---|---|
| PubChem CID | 63202984 |
| Molecular Formula | C7H10ClNS |
| Molecular Weight | 175.68 g/mol |
| Exact Mass | 175.02 |
| IUPAC Name | 2-(3-chlorobutan-2-yl)-1,3-thiazole |
| SMILES | CC(Cl)C(C)c1nccs1 |
| InChI | InChI=1S/C7H10ClNS/c1-5(6(2)8)7-9-3-4-10-7/h3-6H,1-2H3 |
| InChIKey | FWGSTPIVXFAYCQ-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.68 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|