C8H12N2OS — CID 87610344
2-[methyl-[1-(1,3-thiazol-2-yl)ethyl]amino]acetaldehyde (PubChem CID 87610344) has the molecular formula C8H12N2OS and a molecular weight of 184.26 g/mol. Its IUPAC name is 2-[methyl-[1-(1,3-thiazol-2-yl)ethyl]amino]acetaldehyde.
| Compound Name | 2-[methyl-[1-(1,3-thiazol-2-yl)ethyl]amino]acetaldehyde |
|---|---|
| PubChem CID | 87610344 |
| Molecular Formula | C8H12N2OS |
| Molecular Weight | 184.26 g/mol |
| Exact Mass | 184.07 |
| IUPAC Name | 2-[methyl-[1-(1,3-thiazol-2-yl)ethyl]amino]acetaldehyde |
| SMILES | CC(c1nccs1)N(C)CC=O |
| InChI | InChI=1S/C8H12N2OS/c1-7(10(2)4-5-11)8-9-3-6-12-8/h3,5-7H,4H2,1-2H3 |
| InChIKey | HERRGQRFWHVBJG-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 184.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|