C11H19N3S — CID 64990579
N-methyl-N-[1-(1,3-thiazol-2-yl)ethyl]piperidin-3-amine (PubChem CID 64990579) has the molecular formula C11H19N3S and a molecular weight of 225.36 g/mol. Its IUPAC name is N-methyl-N-[1-(1,3-thiazol-2-yl)ethyl]piperidin-3-amine.
| Compound Name | N-methyl-N-[1-(1,3-thiazol-2-yl)ethyl]piperidin-3-amine |
|---|---|
| PubChem CID | 64990579 |
| Molecular Formula | C11H19N3S |
| Molecular Weight | 225.36 g/mol |
| Exact Mass | 225.13 |
| IUPAC Name | N-methyl-N-[1-(1,3-thiazol-2-yl)ethyl]piperidin-3-amine |
| SMILES | CC(c1nccs1)N(C)C1CCCNC1 |
| InChI | InChI=1S/C11H19N3S/c1-9(11-13-6-7-15-11)14(2)10-4-3-5-12-8-10/h6-7,9-10,12H,3-5,8H2,1-2H3 |
| InChIKey | HLWZWVHOTIFKLT-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 225.36 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |