C12H22ClN3 — CID 71637497
(3R)-N-methyl-N-[1-(1H-pyrrol-2-yl)ethyl]piperidin-3-amine;hydrochloride (PubChem CID 71637497) has the molecular formula C12H22ClN3 and a molecular weight of 243.78 g/mol. Its IUPAC name is (3R)-N-methyl-N-[1-(1H-pyrrol-2-yl)ethyl]piperidin-3-amine;hydrochloride.
| Compound Name | (3R)-N-methyl-N-[1-(1H-pyrrol-2-yl)ethyl]piperidin-3-amine;hydrochloride |
|---|---|
| PubChem CID | 71637497 |
| Molecular Formula | C12H22ClN3 |
| Molecular Weight | 243.78 g/mol |
| Exact Mass | 243.15 |
| IUPAC Name | (3R)-N-methyl-N-[1-(1H-pyrrol-2-yl)ethyl]piperidin-3-amine;hydrochloride |
| SMILES | CC(c1ccc[nH]1)N(C)[C@@H]1CCCNC1.Cl |
| InChI | InChI=1S/C12H21N3.ClH/c1-10(12-6-4-8-14-12)15(2)11-5-3-7-13-9-11;/h4,6,8,10-11,13-14H,3,5,7,9H2,1-2H3;1H/t10?,11-;/m1./s1 |
| InChIKey | XLJYAHRABYSNPL-PSDUUTOMSA-N |
| XLogP | 2.18 |
| TPSA | 31.06 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 243.78 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |