C10H21NO4S — CID 130367620
(2S,3R,5R)-5,7-dihydroxy-3-prop-2-enylheptane-2-sulfonamide (PubChem CID 130367620) has the molecular formula C10H21NO4S and a molecular weight of 251.35 g/mol. Its IUPAC name is (2S,3R,5R)-5,7-dihydroxy-3-prop-2-enylheptane-2-sulfonamide.
| Compound Name | (2S,3R,5R)-5,7-dihydroxy-3-prop-2-enylheptane-2-sulfonamide |
|---|---|
| PubChem CID | 130367620 |
| Molecular Formula | C10H21NO4S |
| Molecular Weight | 251.35 g/mol |
| Exact Mass | 251.12 |
| IUPAC Name | (2S,3R,5R)-5,7-dihydroxy-3-prop-2-enylheptane-2-sulfonamide |
| SMILES | C=CC[C@H](C[C@@H](O)CCO)[C@H](C)S(N)(=O)=O |
| InChI | InChI=1S/C10H21NO4S/c1-3-4-9(7-10(13)5-6-12)8(2)16(11,14)15/h3,8-10,12-13H,1,4-7H2,2H3,(H2,11,14,15)/t8-,9+,10-/m0/s1 |
| InChIKey | MLSFXVSBHUYSDV-AEJSXWLSSA-N |
| XLogP | -0.01 |
| TPSA | 100.62 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.35 |
| LogP ≤ 5 | -0.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|