C11H25NO3S — CID 137468905
(3S,4R)-8-hydroxy-3,4,5-trimethyloctane-2-sulfonamide (PubChem CID 137468905) has the molecular formula C11H25NO3S and a molecular weight of 251.39 g/mol. Its IUPAC name is (3S,4R)-8-hydroxy-3,4,5-trimethyloctane-2-sulfonamide.
| Compound Name | (3S,4R)-8-hydroxy-3,4,5-trimethyloctane-2-sulfonamide |
|---|---|
| PubChem CID | 137468905 |
| Molecular Formula | C11H25NO3S |
| Molecular Weight | 251.39 g/mol |
| Exact Mass | 251.16 |
| IUPAC Name | (3S,4R)-8-hydroxy-3,4,5-trimethyloctane-2-sulfonamide |
| SMILES | CC(CCCO)[C@@H](C)[C@H](C)C(C)S(N)(=O)=O |
| InChI | InChI=1S/C11H25NO3S/c1-8(6-5-7-13)9(2)10(3)11(4)16(12,14)15/h8-11,13H,5-7H2,1-4H3,(H2,12,14,15)/t8?,9-,10+,11?/m1/s1 |
| InChIKey | JJYRKAGEMBFARZ-WIFZPCQCSA-N |
| XLogP | 1.34 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 251.39 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |