C7H16O8S2 — CID 174331944
CID 174331944 (PubChem CID 174331944) has the molecular formula C7H16O8S2 and a molecular weight of 292.33 g/mol.
| Compound Name | CID 174331944 |
|---|---|
| PubChem CID | 174331944 |
| Molecular Formula | C7H16O8S2 |
| Molecular Weight | 292.33 g/mol |
| Exact Mass | 292.03 |
| IUPAC Name | — |
| SMILES | C=CCC(CO)CCO.O=S(=O)(O)S(=O)(=O)O |
| InChI | InChI=1S/C7H14O2.H2O6S2/c1-2-3-7(6-9)4-5-8;1-7(2,3)8(4,5)6/h2,7-9H,1,3-6H2;(H,1,2,3)(H,4,5,6) |
| InChIKey | YORXHKQRSKWPCS-UHFFFAOYSA-N |
| XLogP | -0.77 |
| TPSA | 149.20 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.33 |
| LogP ≤ 5 | -0.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'disulphide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|