C6H13NO3S — CID 130367158
(2R,3R)-3-hydroxyhex-5-ene-2-sulfonamide (PubChem CID 130367158) has the molecular formula C6H13NO3S and a molecular weight of 179.24 g/mol. Its IUPAC name is (2R,3R)-3-hydroxyhex-5-ene-2-sulfonamide.
| Compound Name | (2R,3R)-3-hydroxyhex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 130367158 |
| Molecular Formula | C6H13NO3S |
| Molecular Weight | 179.24 g/mol |
| Exact Mass | 179.06 |
| IUPAC Name | (2R,3R)-3-hydroxyhex-5-ene-2-sulfonamide |
| SMILES | C=CC[C@@H](O)[C@@H](C)S(N)(=O)=O |
| InChI | InChI=1S/C6H13NO3S/c1-3-4-6(8)5(2)11(7,9)10/h3,5-6,8H,1,4H2,2H3,(H2,7,9,10)/t5-,6-/m1/s1 |
| InChIKey | DNRNZZMXCQNNOX-PHDIDXHHSA-N |
| XLogP | -0.40 |
| TPSA | 80.39 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 179.24 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|