C8H17NO3S — CID 138668280
(2S,3S)-1-methoxy-3-methylhex-5-ene-2-sulfonamide (PubChem CID 138668280) has the molecular formula C8H17NO3S and a molecular weight of 207.29 g/mol. Its IUPAC name is (2S,3S)-1-methoxy-3-methylhex-5-ene-2-sulfonamide.
| Compound Name | (2S,3S)-1-methoxy-3-methylhex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 138668280 |
| Molecular Formula | C8H17NO3S |
| Molecular Weight | 207.29 g/mol |
| Exact Mass | 207.09 |
| IUPAC Name | (2S,3S)-1-methoxy-3-methylhex-5-ene-2-sulfonamide |
| SMILES | C=CC[C@H](C)[C@@H](COC)S(N)(=O)=O |
| InChI | InChI=1S/C8H17NO3S/c1-4-5-7(2)8(6-12-3)13(9,10)11/h4,7-8H,1,5-6H2,2-3H3,(H2,9,10,11)/t7-,8+/m0/s1 |
| InChIKey | SOVUVEXZRHTHCS-JGVFFNPUSA-N |
| XLogP | 0.50 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.29 |
| LogP ≤ 5 | 0.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|