C10H19NO2S — CID 118910236
(2R,3R)-1-cyclopropyl-3-methylhex-5-ene-2-sulfonamide (PubChem CID 118910236) has the molecular formula C10H19NO2S and a molecular weight of 217.33 g/mol. Its IUPAC name is (2R,3R)-1-cyclopropyl-3-methylhex-5-ene-2-sulfonamide.
| Compound Name | (2R,3R)-1-cyclopropyl-3-methylhex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 118910236 |
| Molecular Formula | C10H19NO2S |
| Molecular Weight | 217.33 g/mol |
| Exact Mass | 217.11 |
| IUPAC Name | (2R,3R)-1-cyclopropyl-3-methylhex-5-ene-2-sulfonamide |
| SMILES | C=CC[C@@H](C)[C@@H](CC1CC1)S(N)(=O)=O |
| InChI | InChI=1S/C10H19NO2S/c1-3-4-8(2)10(14(11,12)13)7-9-5-6-9/h3,8-10H,1,4-7H2,2H3,(H2,11,12,13)/t8-,10-/m1/s1 |
| InChIKey | CMLGSLCCBSIYQR-PSASIEDQSA-N |
| XLogP | 1.66 |
| TPSA | 60.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 217.33 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|