C9H19NO3S — CID 130367305
(2S,3S)-1-ethoxy-3-methylhex-5-ene-2-sulfonamide (PubChem CID 130367305) has the molecular formula C9H19NO3S and a molecular weight of 221.32 g/mol. Its IUPAC name is (2S,3S)-1-ethoxy-3-methylhex-5-ene-2-sulfonamide.
| Compound Name | (2S,3S)-1-ethoxy-3-methylhex-5-ene-2-sulfonamide |
|---|---|
| PubChem CID | 130367305 |
| Molecular Formula | C9H19NO3S |
| Molecular Weight | 221.32 g/mol |
| Exact Mass | 221.11 |
| IUPAC Name | (2S,3S)-1-ethoxy-3-methylhex-5-ene-2-sulfonamide |
| SMILES | C=CC[C@H](C)[C@@H](COCC)S(N)(=O)=O |
| InChI | InChI=1S/C9H19NO3S/c1-4-6-8(3)9(7-13-5-2)14(10,11)12/h4,8-9H,1,5-7H2,2-3H3,(H2,10,11,12)/t8-,9+/m0/s1 |
| InChIKey | CSBYAAMGHKKKSK-DTWKUNHWSA-N |
| XLogP | 0.89 |
| TPSA | 69.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.32 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|