C25H35NO4S — CID 172862404
9-(4-methoxyphenyl)-8-[(4-methoxyphenyl)methyl]-4-methylnon-1-ene-5-sulfonamide (PubChem CID 172862404) has the molecular formula C25H35NO4S and a molecular weight of 445.63 g/mol. Its IUPAC name is 9-(4-methoxyphenyl)-8-[(4-methoxyphenyl)methyl]-4-methylnon-1-ene-5-sulfonamide.
| Compound Name | 9-(4-methoxyphenyl)-8-[(4-methoxyphenyl)methyl]-4-methylnon-1-ene-5-sulfonamide |
|---|---|
| PubChem CID | 172862404 |
| Molecular Formula | C25H35NO4S |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.23 |
| IUPAC Name | 9-(4-methoxyphenyl)-8-[(4-methoxyphenyl)methyl]-4-methylnon-1-ene-5-sulfonamide |
| SMILES | C=CCC(C)C(CCC(Cc1ccc(OC)cc1)Cc1ccc(OC)cc1)S(N)(=O)=O |
| InChI | InChI=1S/C25H35NO4S/c1-5-6-19(2)25(31(26,27)28)16-11-22(17-20-7-12-23(29-3)13-8-20)18-21-9-14-24(30-4)15-10-21/h5,7-10,12-15,19,22,25H,1,6,11,16-18H2,2-4H3,(H2,26,27,28) |
| InChIKey | ZNLYAZYTKXRDFB-UHFFFAOYSA-N |
| XLogP | 4.75 |
| TPSA | 78.62 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|