C14H26S — CID 155281274
(2,5-dimethyl-4-methylsulfanyloct-7-enyl)cyclopropane (PubChem CID 155281274) has the molecular formula C14H26S and a molecular weight of 226.43 g/mol. Its IUPAC name is (2,5-dimethyl-4-methylsulfanyloct-7-enyl)cyclopropane.
| Compound Name | (2,5-dimethyl-4-methylsulfanyloct-7-enyl)cyclopropane |
|---|---|
| PubChem CID | 155281274 |
| Molecular Formula | C14H26S |
| Molecular Weight | 226.43 g/mol |
| Exact Mass | 226.18 |
| IUPAC Name | (2,5-dimethyl-4-methylsulfanyloct-7-enyl)cyclopropane |
| SMILES | C=CCC(C)C(CC(C)CC1CC1)SC |
| InChI | InChI=1S/C14H26S/c1-5-6-12(3)14(15-4)10-11(2)9-13-7-8-13/h5,11-14H,1,6-10H2,2-4H3 |
| InChIKey | OBEFXAMGACKWCG-UHFFFAOYSA-N |
| XLogP | 4.76 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.43 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|