C10H21NS — CID 146361099
S-[(4R,5S)-2,5-dimethyloct-7-en-4-yl]thiohydroxylamine (PubChem CID 146361099) has the molecular formula C10H21NS and a molecular weight of 187.35 g/mol. Its IUPAC name is S-[(4R,5S)-2,5-dimethyloct-7-en-4-yl]thiohydroxylamine.
| Compound Name | S-[(4R,5S)-2,5-dimethyloct-7-en-4-yl]thiohydroxylamine |
|---|---|
| PubChem CID | 146361099 |
| Molecular Formula | C10H21NS |
| Molecular Weight | 187.35 g/mol |
| Exact Mass | 187.14 |
| IUPAC Name | S-[(4R,5S)-2,5-dimethyloct-7-en-4-yl]thiohydroxylamine |
| SMILES | C=CC[C@H](C)[C@@H](CC(C)C)SN |
| InChI | InChI=1S/C10H21NS/c1-5-6-9(4)10(12-11)7-8(2)3/h5,8-10H,1,6-7,11H2,2-4H3/t9-,10+/m0/s1 |
| InChIKey | DYHQZGSWPAXNME-VHSXEESVSA-N |
| XLogP | 3.22 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 187.35 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|