C11H21Br — CID 165445728
5-(bromomethyl)-4,7-dimethyloct-1-ene (PubChem CID 165445728) has the molecular formula C11H21Br and a molecular weight of 233.19 g/mol. Its IUPAC name is 5-(bromomethyl)-4,7-dimethyloct-1-ene.
| Compound Name | 5-(bromomethyl)-4,7-dimethyloct-1-ene |
|---|---|
| PubChem CID | 165445728 |
| Molecular Formula | C11H21Br |
| Molecular Weight | 233.19 g/mol |
| Exact Mass | 232.08 |
| IUPAC Name | 5-(bromomethyl)-4,7-dimethyloct-1-ene |
| SMILES | C=CCC(C)C(CBr)CC(C)C |
| InChI | InChI=1S/C11H21Br/c1-5-6-10(4)11(8-12)7-9(2)3/h5,9-11H,1,6-8H2,2-4H3 |
| InChIKey | RMBAAFOELBDQLA-UHFFFAOYSA-N |
| XLogP | 4.26 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.19 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|