C11H21N — CID 138535342
4-(2-methylpropyl)hepta-1,6-dien-2-amine (PubChem CID 138535342) has the molecular formula C11H21N and a molecular weight of 167.30 g/mol. Its IUPAC name is 4-(2-methylpropyl)hepta-1,6-dien-2-amine.
| Compound Name | 4-(2-methylpropyl)hepta-1,6-dien-2-amine |
|---|---|
| PubChem CID | 138535342 |
| Molecular Formula | C11H21N |
| Molecular Weight | 167.30 g/mol |
| Exact Mass | 167.17 |
| IUPAC Name | 4-(2-methylpropyl)hepta-1,6-dien-2-amine |
| SMILES | C=CCC(CC(=C)N)CC(C)C |
| InChI | InChI=1S/C11H21N/c1-5-6-11(7-9(2)3)8-10(4)12/h5,9,11H,1,4,6-8,12H2,2-3H3 |
| InChIKey | LLZFGHFHRBKDQX-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 167.30 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|