C6H14N2 — CID 19088326
2-prop-2-enylpropane-1,3-diamine (PubChem CID 19088326) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is 2-prop-2-enylpropane-1,3-diamine.
| Compound Name | 2-prop-2-enylpropane-1,3-diamine |
|---|---|
| PubChem CID | 19088326 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 2-prop-2-enylpropane-1,3-diamine |
| SMILES | C=CCC(CN)CN |
| InChI | InChI=1S/C6H14N2/c1-2-3-6(4-7)5-8/h2,6H,1,3-5,7-8H2 |
| InChIKey | OPBRDYYWYDROKV-UHFFFAOYSA-N |
| XLogP | 0.10 |
| TPSA | 52.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|