C8H17N — CID 129255783
4,5-dimethylhex-1-en-2-amine (PubChem CID 129255783) has the molecular formula C8H17N and a molecular weight of 127.23 g/mol. Its IUPAC name is 4,5-dimethylhex-1-en-2-amine.
| Compound Name | 4,5-dimethylhex-1-en-2-amine |
|---|---|
| PubChem CID | 129255783 |
| Molecular Formula | C8H17N |
| Molecular Weight | 127.23 g/mol |
| Exact Mass | 127.14 |
| IUPAC Name | 4,5-dimethylhex-1-en-2-amine |
| SMILES | C=C(N)CC(C)C(C)C |
| InChI | InChI=1S/C8H17N/c1-6(2)7(3)5-8(4)9/h6-7H,4-5,9H2,1-3H3 |
| InChIKey | CASNVQOKGQFWAP-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 127.23 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |