C10H15N — CID 167039283
1-(4,5-dimethylhex-1-en-2-yl)-1-azacycloprop-2-yne (PubChem CID 167039283) has the molecular formula C10H15N and a molecular weight of 149.24 g/mol. Its IUPAC name is 1-(4,5-dimethylhex-1-en-2-yl)-1-azacycloprop-2-yne.
| Compound Name | 1-(4,5-dimethylhex-1-en-2-yl)-1-azacycloprop-2-yne |
|---|---|
| PubChem CID | 167039283 |
| Molecular Formula | C10H15N |
| Molecular Weight | 149.24 g/mol |
| Exact Mass | 149.12 |
| IUPAC Name | 1-(4,5-dimethylhex-1-en-2-yl)-1-azacycloprop-2-yne |
| SMILES | C=C(CC(C)C(C)C)N1C#C1 |
| InChI | InChI=1S/C10H15N/c1-8(2)9(3)7-10(4)11-5-6-11/h8-9H,4,7H2,1-3H3 |
| InChIKey | YZTSCOTZZHEAMD-UHFFFAOYSA-N |
| XLogP | 2.42 |
| TPSA | 3.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 149.24 |
| LogP ≤ 5 | 2.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|