C12H25N — CID 155010763
4,5,6,7-tetramethyloct-1-en-2-amine (PubChem CID 155010763) has the molecular formula C12H25N and a molecular weight of 183.34 g/mol. Its IUPAC name is 4,5,6,7-tetramethyloct-1-en-2-amine.
| Compound Name | 4,5,6,7-tetramethyloct-1-en-2-amine |
|---|---|
| PubChem CID | 155010763 |
| Molecular Formula | C12H25N |
| Molecular Weight | 183.34 g/mol |
| Exact Mass | 183.20 |
| IUPAC Name | 4,5,6,7-tetramethyloct-1-en-2-amine |
| SMILES | C=C(N)CC(C)C(C)C(C)C(C)C |
| InChI | InChI=1S/C12H25N/c1-8(2)11(5)12(6)9(3)7-10(4)13/h8-9,11-12H,4,7,13H2,1-3,5-6H3 |
| InChIKey | CVHNWVKFFRBIIL-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 183.34 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |