C14H28 — CID 177053825
2,3,5,7,8-pentamethylnon-1-ene (PubChem CID 177053825) has the molecular formula C14H28 and a molecular weight of 196.38 g/mol. Its IUPAC name is 2,3,5,7,8-pentamethylnon-1-ene.
| Compound Name | 2,3,5,7,8-pentamethylnon-1-ene |
|---|---|
| PubChem CID | 177053825 |
| Molecular Formula | C14H28 |
| Molecular Weight | 196.38 g/mol |
| Exact Mass | 196.22 |
| IUPAC Name | 2,3,5,7,8-pentamethylnon-1-ene |
| SMILES | C=C(C)C(C)CC(C)CC(C)C(C)C |
| InChI | InChI=1S/C14H28/c1-10(2)13(6)8-12(5)9-14(7)11(3)4/h11-14H,1,8-9H2,2-7H3 |
| InChIKey | UUFLGQUUPIKNOO-UHFFFAOYSA-N |
| XLogP | 4.91 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.38 |
| LogP ≤ 5 | 4.91 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|