C6H13NS — CID 155008236
S-(2,3-dimethylbut-3-enyl)thiohydroxylamine (PubChem CID 155008236) has the molecular formula C6H13NS and a molecular weight of 131.24 g/mol. Its IUPAC name is S-(2,3-dimethylbut-3-enyl)thiohydroxylamine.
| Compound Name | S-(2,3-dimethylbut-3-enyl)thiohydroxylamine |
|---|---|
| PubChem CID | 155008236 |
| Molecular Formula | C6H13NS |
| Molecular Weight | 131.24 g/mol |
| Exact Mass | 131.08 |
| IUPAC Name | S-(2,3-dimethylbut-3-enyl)thiohydroxylamine |
| SMILES | C=C(C)C(C)CSN |
| InChI | InChI=1S/C6H13NS/c1-5(2)6(3)4-8-7/h6H,1,4,7H2,2-3H3 |
| InChIKey | SVCUPIJQYNIMNE-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 131.24 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'sulphur_nitrogen_single_bond', 'substructure': 'N/A'} |
|---|