C14H28NO+ — CID 91361120
2-(4,5-dimethylhexa-1,5-dien-2-yloxy)ethyl-ethyl-dimethylazanium (PubChem CID 91361120) has the molecular formula C14H28NO+ and a molecular weight of 226.38 g/mol. Its IUPAC name is 2-(4,5-dimethylhexa-1,5-dien-2-yloxy)ethyl-ethyl-dimethylazanium.
| Compound Name | 2-(4,5-dimethylhexa-1,5-dien-2-yloxy)ethyl-ethyl-dimethylazanium |
|---|---|
| PubChem CID | 91361120 |
| Molecular Formula | C14H28NO+ |
| Molecular Weight | 226.38 g/mol |
| Exact Mass | 226.22 |
| IUPAC Name | 2-(4,5-dimethylhexa-1,5-dien-2-yloxy)ethyl-ethyl-dimethylazanium |
| SMILES | C=C(CC(C)C(=C)C)OCC[N+](C)(C)CC |
| InChI | InChI=1S/C14H28NO/c1-8-15(6,7)9-10-16-14(5)11-13(4)12(2)3/h13H,2,5,8-11H2,1,3-4,6-7H3/q+1 |
| InChIKey | VOEHHCNKWZIOAW-UHFFFAOYSA-N |
| XLogP | 3.22 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.38 |
| LogP ≤ 5 | 3.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|