C14H30NO2+ — CID 123351545
dimethyl-[2-(3-methylbutanoyloxy)ethyl]-pentylazanium (PubChem CID 123351545) has the molecular formula C14H30NO2+ and a molecular weight of 244.40 g/mol. Its IUPAC name is dimethyl-[2-(3-methylbutanoyloxy)ethyl]-pentylazanium.
| Compound Name | dimethyl-[2-(3-methylbutanoyloxy)ethyl]-pentylazanium |
|---|---|
| PubChem CID | 123351545 |
| Molecular Formula | C14H30NO2+ |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | dimethyl-[2-(3-methylbutanoyloxy)ethyl]-pentylazanium |
| SMILES | CCCCC[N+](C)(C)CCOC(=O)CC(C)C |
| InChI | InChI=1S/C14H30NO2/c1-6-7-8-9-15(4,5)10-11-17-14(16)12-13(2)3/h13H,6-12H2,1-5H3/q+1 |
| InChIKey | HAHNAIBBKRIWJJ-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_2', 'substructure': 'N/A'} |
|---|