C12H22 — CID 162769064
(6R)-2,6,7-trimethyl-3-methylideneoct-1-ene (PubChem CID 162769064) has the molecular formula C12H22 and a molecular weight of 166.31 g/mol. Its IUPAC name is (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene.
| Compound Name | (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene |
|---|---|
| PubChem CID | 162769064 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene |
| SMILES | C=C(C)C(=C)CC[C@@H](C)C(C)C |
| InChI | InChI=1S/C12H22/c1-9(2)11(5)7-8-12(6)10(3)4/h10,12H,1,5,7-8H2,2-4,6H3/t12-/m1/s1 |
| InChIKey | VDCXSCMUALCAMD-GFCCVEGCSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|