About (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene
(6R)-2,6,7-trimethyl-3-methylideneoct-1-ene (PubChem CID 162769064) has the molecular formula C12H22
and a molecular weight of 166.31 g/mol. Its IUPAC name is (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene.
Molecular Properties
| Compound Name | (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene |
| PubChem CID | 162769064 |
| Molecular Formula | C12H22 |
| Molecular Weight | 166.31 g/mol |
| Exact Mass | 166.17 |
| IUPAC Name | (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene |
| SMILES | C=C(C)C(=C)CC[C@@H](C)C(C)C |
| InChI | InChI=1S/C12H22/c1-9(2)11(5)7-8-12(6)10(3)4/h10,12H,1,5,7-8H2,2-4,6H3/t12-/m1/s1 |
| InChIKey | VDCXSCMUALCAMD-GFCCVEGCSA-N |
| XLogP | 4.19 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 5 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.31 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|
Analyze (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene?
The IUPAC name of (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene (CID 162769064) is (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene.
What is the SMILES notation for (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene?
The canonical SMILES for (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene is C=C(C)C(=C)CC[C@@H](C)C(C)C.
What is the InChIKey of (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene?
The InChIKey is VDCXSCMUALCAMD-GFCCVEGCSA-N. The full InChI is InChI=1S/C12H22/c1-9(2)11(5)7-8-12(6)10(3)4/h10,12H,1,5,7-8H2,2-4,6H3/t12-/m1/s1.
What are the key properties of (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene?
(6R)-2,6,7-trimethyl-3-methylideneoct-1-ene has a molecular weight of 166.31 g/mol, XLogP of 4.19, 5 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for (6R)-2,6,7-trimethyl-3-methylideneoct-1-ene is sourced from PubChem (CID 162769064), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).