C11H21NO2 — CID 137397134
N-formyl-3,4-dimethyl-N-propan-2-ylpentanamide (PubChem CID 137397134) has the molecular formula C11H21NO2 and a molecular weight of 199.29 g/mol. Its IUPAC name is N-formyl-3,4-dimethyl-N-propan-2-ylpentanamide.
| Compound Name | N-formyl-3,4-dimethyl-N-propan-2-ylpentanamide |
|---|---|
| PubChem CID | 137397134 |
| Molecular Formula | C11H21NO2 |
| Molecular Weight | 199.29 g/mol |
| Exact Mass | 199.16 |
| IUPAC Name | N-formyl-3,4-dimethyl-N-propan-2-ylpentanamide |
| SMILES | CC(C)C(C)CC(=O)N(C=O)C(C)C |
| InChI | InChI=1S/C11H21NO2/c1-8(2)10(5)6-11(14)12(7-13)9(3)4/h7-10H,6H2,1-5H3 |
| InChIKey | ZPKBGGIIOWBOQS-UHFFFAOYSA-N |
| XLogP | 2.06 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.29 |
| LogP ≤ 5 | 2.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|