C8H18N2 — CID 156737008
3-N,3-N,4-trimethylpent-1-ene-2,3-diamine (PubChem CID 156737008) has the molecular formula C8H18N2 and a molecular weight of 142.25 g/mol. Its IUPAC name is 3-N,3-N,4-trimethylpent-1-ene-2,3-diamine.
| Compound Name | 3-N,3-N,4-trimethylpent-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 156737008 |
| Molecular Formula | C8H18N2 |
| Molecular Weight | 142.25 g/mol |
| Exact Mass | 142.15 |
| IUPAC Name | 3-N,3-N,4-trimethylpent-1-ene-2,3-diamine |
| SMILES | C=C(N)C(C(C)C)N(C)C |
| InChI | InChI=1S/C8H18N2/c1-6(2)8(7(3)9)10(4)5/h6,8H,3,9H2,1-2,4-5H3 |
| InChIKey | SGHSRVHBOKDLOW-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 142.25 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |