C6H14N2 — CID 89045153
3-N,3-N-dimethylbut-1-ene-2,3-diamine (PubChem CID 89045153) has the molecular formula C6H14N2 and a molecular weight of 114.19 g/mol. Its IUPAC name is 3-N,3-N-dimethylbut-1-ene-2,3-diamine.
| Compound Name | 3-N,3-N-dimethylbut-1-ene-2,3-diamine |
|---|---|
| PubChem CID | 89045153 |
| Molecular Formula | C6H14N2 |
| Molecular Weight | 114.19 g/mol |
| Exact Mass | 114.12 |
| IUPAC Name | 3-N,3-N-dimethylbut-1-ene-2,3-diamine |
| SMILES | C=C(N)C(C)N(C)C |
| InChI | InChI=1S/C6H14N2/c1-5(7)6(2)8(3)4/h6H,1,7H2,2-4H3 |
| InChIKey | RWNJGSMDACCFMQ-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 114.19 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |